CAS 944059-24-9

B-1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid

Description:

B-1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid is an organic compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a pyrrolo[2,3-b]pyridine core, which contributes to its aromaticity and potential biological activity. The presence of the boronic acid group enhances its solubility in polar solvents and allows for participation in cross-coupling reactions, making it valuable in medicinal chemistry and material science. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Its structural characteristics, including the arrangement of nitrogen and carbon atoms, influence its reactivity and stability. Overall, B-1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid is a versatile compound with significant implications in synthetic organic chemistry and potential applications in drug development.

Formula: C₇H₇BN₂O₂

InChI: InChI=1S/C7H7BN2O2/c11-8(12)6-3-5-1-2-9-7(5)10-4-6/h1-4,11-12H,(H,9,10)

InChI key: InChIKey=KCHKRCSVKZQYCA-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C2C(=NC1)NC=C2

Synonyms:

• B-1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid
• boronic acid, B-1H-pyrrolo[2,3-b]pyridin-5-yl-
• {1H-pyrrolo[2,3-b]pyridin-5-yl}boronic acid

(1H-Pyrrolo[2,3-b]Pyridin-5-yl)Boronic Acid

CAS: 944059-24-9

Formula: C₇H₇BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.9537

Ref: IN-DA00H7KP

1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid

CAS: 944059-24-9

1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid

Purity: 97%

Molecular weight: 161.95368g/mol

Ref: 54-OR308041

(1H-Pyrrolo[2,3-b]pyridin-5-yl)boronic acid

CAS: 944059-24-9

Formula: C₇H₇BN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.96

Ref: 10-F236668