CAS 944060-66-6

2-chloro-8-methoxy-quinazoline

Description:

2-Chloro-8-methoxy-quinazoline is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a chlorine atom at the second position and a methoxy group at the eighth position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. It is often studied for its potential biological activities, including its role in medicinal chemistry as a scaffold for drug development. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methoxy group may enhance its lipophilicity. Overall, 2-chloro-8-methoxy-quinazoline is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications and the biological activities associated with quinazoline derivatives.

Formula: C₉H₇ClN₂O

InChI: InChI=1/C9H7ClN2O/c1-13-7-4-2-3-6-5-11-9(10)12-8(6)7/h2-5H,1H3

SMILES: COc1cccc2cnc(Cl)nc12

Synonyms:

• 2-Chloro-8-methoxyquinazoline
• Quinazoline, 2-Chloro-8-Methoxy-

Quinazoline, 2-​chloro-​8-​methoxy-

CAS: 944060-66-6

Formula: C₉H₇ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 194.6177

Ref: IN-DA006B33

2-Chloro-8-methoxyquinazoline

CAS: 944060-66-6

2-Chloro-8-methoxyquinazoline

Purity: 98%

Molecular weight: 194.62g/mol

Ref: 54-OR77982

2-Chloro-8-methoxyquinazoline

CAS: 944060-66-6

Formula: C₉H₇ClN₂O

Purity: 98%

Molecular weight: 194.62

Ref: 10-F230528

2-Chloro-8-methoxyquinazoline

Controlled Product

CAS: 944060-66-6

Formula: C₉H₇ClN₂O

Color and Shape: Neat

Molecular weight: 194.618

Ref: TR-C375303