CAS 944129-07-1

B-(4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid

Description:

B-(4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. The compound features a chlorine atom and a fluorine atom, as well as a methoxy group, which contribute to its unique chemical properties and reactivity. Typically, boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The presence of electron-withdrawing groups, such as chlorine and fluorine, can influence the acidity of the boronic acid and its reactivity in cross-coupling reactions, such as Suzuki coupling. Additionally, the methoxy group can enhance solubility and stability in various solvents. Overall, this compound's structural features make it a useful building block in synthetic organic chemistry, particularly in the synthesis of complex molecules.

Formula: C₇H₇BClFO₃

InChI: InChI=1S/C7H7BClFO3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3,11-12H,1H3

InChI key: InChIKey=GDJCQSNQOHRAGY-UHFFFAOYSA-N

SMILES: O(C)C1=C(F)C(B(O)O)=CC=C1Cl

Synonyms:

• 4-Chloro-2-fluoro-3-methoxyphenylboronic acid
• B-(4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid
• Boronic acid, B-(4-chloro-2-fluoro-3-methoxyphenyl)-

4-Chloro-2-fluoro-3-methoxyphenylboronic acid

CAS: 944129-07-1

Formula: C₇H₇BClFO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 204.3911

Ref: IN-DA00367R

4-Chloro-2-fluoro-3-methoxyphenylboronic acid

CAS: 944129-07-1

4-Chloro-2-fluoro-3-methoxyphenylboronic acid

Purity: 98%

Molecular weight: 204.39g/mol

Ref: 54-PC412304

(4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid

CAS: 944129-07-1

Formula: C₇H₇BClFO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 204.39

Ref: 10-F215966