CAS 94413-65-7
:5-(Aminomethyl)-3-pyridinecarbonitrile
Description:
5-(Aminomethyl)-3-pyridinecarbonitrile, with the CAS number 94413-65-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aminomethyl group (-CH2NH2) attached to the pyridine ring, as well as a cyano group (-C≡N) at the 3-position, contributing to its reactivity and potential applications in various chemical syntheses. The presence of both the amino and cyano functional groups suggests that it may participate in nucleophilic reactions and serve as a building block in the synthesis of more complex molecules. Additionally, the compound is likely to exhibit polar characteristics due to the presence of the amino and cyano groups, which can influence its solubility in different solvents. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry and drug development. Overall, 5-(Aminomethyl)-3-pyridinecarbonitrile is a versatile compound with potential applications in various fields of chemistry.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c8-2-6-1-7(3-9)5-10-4-6/h1,4-5H,2,8H2
InChI key:InChIKey=WWGJGUXPSUGYRY-UHFFFAOYSA-N
SMILES:C(N)C=1C=C(C#N)C=NC1
Synonyms:- 3-Pyridinecarbonitrile, 5-(aminomethyl)-
- 5-(Aminomethyl)-3-pyridinecarbonitrile
- 5-Aminomethylpyridine-3-carbonitrile
- 5-Aminomethylnicotinonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
