CymitQuimica logo

CAS 94413-66-8

:

3,5-Bis(aminomethyl)pyridine

Description:
3,5-Bis(aminomethyl)pyridine is an organic compound characterized by its pyridine ring substituted with two aminomethyl groups at the 3 and 5 positions. This structure imparts both basic and nucleophilic properties to the molecule, making it useful in various chemical applications. The presence of the amino groups enhances its solubility in polar solvents and allows for potential interactions with electrophiles. Typically, this compound appears as a solid at room temperature and can be synthesized through specific reactions involving pyridine derivatives. It is often utilized in the synthesis of ligands for metal complexes, catalysts, and in the development of pharmaceuticals due to its ability to form coordination complexes. Additionally, its basicity can facilitate reactions in organic synthesis, making it a valuable intermediate in chemical processes. Safety data indicates that, like many amines, it should be handled with care, as it may be irritating to the skin and eyes. Proper safety protocols should be followed when working with this compound in laboratory settings.
Formula:C7H11N3
InChI:InChI=1/C7H11N3/c8-2-6-1-7(3-9)5-10-4-6/h1,4-5H,2-3,8-9H2
SMILES:c1c(CN)cncc1CN
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.