
CAS 94413-67-9
:4-Phenyl-2-pyridinemethanamine
Description:
4-Phenyl-2-pyridinemethanamine, with the CAS number 94413-67-9, is an organic compound characterized by its structure, which includes a pyridine ring and a phenyl group attached to a methanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The presence of both the pyridine and phenyl groups suggests that it may exhibit aromatic characteristics, contributing to its stability and reactivity. Additionally, the compound may show solubility in polar solvents, depending on the specific functional groups and their interactions. As with many organic compounds, safety data should be consulted for handling and storage, as amines can be hazardous. Overall, 4-Phenyl-2-pyridinemethanamine represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c13-9-12-8-11(6-7-14-12)10-4-2-1-3-5-10/h1-8H,9,13H2
InChI key:InChIKey=KUGZSPNESAJGED-UHFFFAOYSA-N
SMILES:C(N)C1=CC(=CC=N1)C2=CC=CC=C2
Synonyms:- 4-Phenyl-2-pyridinemethanamine
- (4-Phenylpyridin-2-yl)methanamine
- 2-(Aminomethyl)-4-phenylpyridine
- 2-Pyridinemethanamine, 4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.