CAS 94413-69-1
:4-Pyridinecarboxylic acid, 2-(aminomethyl)-, methyl ester
Description:
4-Pyridinecarboxylic acid, 2-(aminomethyl)-, methyl ester, also known as methyl 2-(aminomethyl)nicotinate, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of the aminomethyl group introduces an amine functionality, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a white to off-white solid and is soluble in polar solvents due to its polar functional groups. It may exhibit biological activity, making it of interest in pharmaceutical research. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-12-8(11)6-2-3-10-7(4-6)5-9/h2-4H,5,9H2,1H3
InChI key:InChIKey=SJROINROTNRUMX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(CN)N=CC1
Synonyms:- 2-Aminomethyl-isonicotinic acid methyl ester
- 4-Carbomethoxy-2-pyridinemethanamine
- 4-Pyridinecarboxylic Acid, 2-(Aminomethyl)-, Methyl Ester
- Methyl 2-(aminomethyl)isonicotinate
- Methyl 2-(aminomethyl)pyridine-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
