CymitQuimica logo

CAS 944133-94-2

:

Methyl 5-(1-pyrrolidinyl)-2-pyrazinecarboxylate

Description:
Methyl 5-(1-pyrrolidinyl)-2-pyrazinecarboxylate, identified by its CAS number 944133-94-2, is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and esters, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The pyrrolidine group may impart certain pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of the methyl ester functional group suggests that it may undergo hydrolysis under certain conditions, leading to the corresponding carboxylic acid. Its molecular structure may allow for interactions with biological targets, which could be explored in drug development. Overall, Methyl 5-(1-pyrrolidinyl)-2-pyrazinecarboxylate represents a compound with potential applications in various fields, including pharmaceuticals and organic synthesis, due to its distinctive chemical characteristics.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c1-15-10(14)8-6-12-9(7-11-8)13-4-2-3-5-13/h6-7H,2-5H2,1H3
InChI key:InChIKey=NFPDGKFKCUNPHZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=CC(=NC1)N2CCCC2
Synonyms:
  • 2-Pyrazinecarboxylic acid, 5-(1-pyrrolidinyl)-, methyl ester
  • Methyl 5-(1-pyrrolidinyl)-2-pyrazinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.