CAS 94425-22-6
:6-amino-5,6,7,8-tetrahydronaphthalen-1-ol
Description:
6-amino-5,6,7,8-tetrahydronaphthalen-1-ol is an organic compound characterized by its bicyclic structure, which consists of a naphthalene core with an amino group and a hydroxyl group. This compound features a tetrahydronaphthalene framework, indicating that it has undergone partial hydrogenation, resulting in a saturated structure. The presence of the amino group (-NH2) contributes to its basicity and potential reactivity, while the hydroxyl group (-OH) imparts alcohol characteristics, making it capable of forming hydrogen bonds. This compound may exhibit solubility in polar solvents due to the hydroxyl group, while its hydrophobic naphthalene structure may influence its interactions in nonpolar environments. It is often studied in the context of medicinal chemistry and organic synthesis, where its functional groups can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound's unique structure may confer specific biological activities, making it of interest in pharmaceutical research.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-3,8,12H,4-6,11H2
SMILES:c1cc2CC(CCc2c(c1)O)N
Synonyms:- 1-Naphthalenol, 6-Amino-5,6,7,8-Tetrahydro-
- 5-Hydroxy-2-aminotetralin
- 6-Amino-5,6,7,8-tetrahydro-1-naphthalenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

