
CAS 944276-70-4
:1-Naphthalenecarboxylic acid, 2-bromo-, ethyl ester
Description:
1-Naphthalenecarboxylic acid, 2-bromo-, ethyl ester, also known by its CAS number 944276-70-4, is an organic compound characterized by its naphthalene ring structure substituted with a carboxylic acid group and a bromine atom at the 2-position, along with an ethyl ester functional group. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its hydrophobic naphthalene core. The presence of the bromine atom can impart unique reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The ethyl ester group suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, this compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its synthesis and applications could be relevant in fields such as pharmaceuticals, agrochemicals, or materials science, depending on the specific properties and reactivity of the compound.
Formula:C13H11BrO2
InChI:InChI=1S/C13H11BrO2/c1-2-16-13(15)12-10-6-4-3-5-9(10)7-8-11(12)14/h3-8H,2H2,1H3
InChI key:InChIKey=DDVXCDUXTFEUSO-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C2=C(C=CC1Br)C=CC=C2
Synonyms:- 1-Naphthalenecarboxylic acid, 2-bromo-, ethyl ester
- Ethyl 2-bromonaphthalene-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.