CAS 944279-23-6

B-[4-[2-(Dimethylamino)ethoxy]-3-fluorophenyl]boronic acid

Description:

B-[4-[2-(Dimethylamino)ethoxy]-3-fluorophenyl]boronic acid, with the CAS number 944279-23-6, is a boronic acid derivative characterized by its unique functional groups that contribute to its chemical properties. This compound features a boron atom bonded to a phenyl ring that is further substituted with a fluorine atom and an ethoxy group containing a dimethylamino moiety. The presence of the boronic acid functional group allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can participate in reversible covalent bonding with diols and other nucleophiles. The dimethylamino group enhances its solubility and may influence its biological activity by modulating interactions with biological targets. Additionally, the fluorine atom can affect the compound's electronic properties and lipophilicity, which are critical for drug design. Overall, this compound's structure suggests it may have utility in various chemical and biological applications, particularly in the fields of organic synthesis and drug discovery.

Formula: C₁₀H₁₅BFNO₃

InChI: InChI=1S/C10H15BFNO3/c1-13(2)5-6-16-10-4-3-8(11(14)15)7-9(10)12/h3-4,7,14-15H,5-6H2,1-2H3

InChI key: InChIKey=WIRZCZXOJWPDTM-UHFFFAOYSA-N

SMILES: O(CCN(C)C)C1=C(F)C=C(B(O)O)C=C1

Synonyms:

• Boronic acid, B-[4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]-
• [4-[2-(Dimethylamino)ethoxy]-3-fluorophenyl]boronic acid
• B-[4-[2-(Dimethylamino)ethoxy]-3-fluorophenyl]boronic acid

(4-(2-(Dimethylamino)ethoxy)-3-fluorophenyl)boronic acid

CAS: 944279-23-6

Formula: C₁₀H₁₅BFNO₃

Molecular weight: 227.0404

Ref: IN-DA01DM4A