CAS 944279-28-1
:1-[3-(4-Bromo-2-fluorophenoxy)propyl]pyrrolidine
Description:
1-[3-(4-Bromo-2-fluorophenoxy)propyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a propyl chain linked to a phenoxy group that is further substituted with bromine and fluorine atoms. The presence of the bromine and fluorine substituents on the aromatic ring contributes to its potential biological activity and lipophilicity, influencing its interactions with biological targets. This compound may exhibit properties typical of amines and ethers, such as basicity and potential reactivity with electrophiles. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrrolidine moiety, which is often found in various bioactive compounds. Additionally, the compound's solubility and stability would depend on the specific functional groups and their arrangement, making it a candidate for further investigation in drug design and synthesis.
Formula:C13H17BrFNO
InChI:InChI=1S/C13H17BrFNO/c14-11-4-5-13(12(15)10-11)17-9-3-8-16-6-1-2-7-16/h4-5,10H,1-3,6-9H2
InChI key:InChIKey=ZEICPQIBTYBFNN-UHFFFAOYSA-N
SMILES:O(CCCN1CCCC1)C2=C(F)C=C(Br)C=C2
Synonyms:- Pyrrolidine, 1-[3-(4-bromo-2-fluorophenoxy)propyl]-
- 1-[3-(4-Bromo-2-fluorophenoxy)propyl]pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.