CAS 944283-08-3
:N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valine 2-carboxy-2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl ester
Description:
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valine 2-carboxy-2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl ester, commonly referred to as Fmoc-Val-OEt, is a synthetic compound primarily used in peptide synthesis as a protecting group for amino acids. This compound features a fluorenylmethoxycarbonyl (Fmoc) group, which is a widely utilized protective group due to its stability under basic conditions and ease of removal under mild acidic conditions. The structure includes a valine residue, which is an essential amino acid, and an ethyl ester that enhances solubility and reactivity during synthesis. The presence of the dimethylethoxycarbonyl group provides additional steric hindrance, which can influence the reactivity and selectivity during coupling reactions. This compound is typically used in solid-phase peptide synthesis, where it plays a crucial role in the sequential addition of amino acids to form peptides. Its unique structural features contribute to its effectiveness in facilitating the synthesis of complex peptide sequences while maintaining the integrity of the amino acid side chains.
Formula:C28H34N2O8
InChI:InChI=1S/C28H34N2O8/c1-16(2)23(25(33)36-15-22(24(31)32)29-27(35)38-28(3,4)5)30-26(34)37-14-21-19-12-8-6-10-17(19)18-11-7-9-13-20(18)21/h6-13,16,21-23H,14-15H2,1-5H3,(H,29,35)(H,30,34)(H,31,32)/t22-,23-/m0/s1
InChI key:InChIKey=MZUSTCBLZOMXJJ-GOTSBHOMSA-N
SMILES:C(OC(N[C@H](C(OC[C@H](NC(OC(C)(C)C)=O)C(O)=O)=O)C(C)C)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valine 2-carboxy-2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl ester
- L-Valine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 2-carboxy-2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-3-(((S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanoyl)oxy)-2-((tert-butoxycarbonyl)amino)propanoic acid
CAS:(S)-3-(((S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbutanoyl)oxy)-2-((tert-butoxycarbonyl)amino)propanoic acidPurity:98%Molecular weight:526.59g/molBoc-Ser(Val-Fmoc)-OH
CAS:Boc-Ser(Val-Fmoc)-OH is a biomolecule that is used for the synthesis of peptides. It has been shown to be an efficient synthetic method for the synthesis of peptides and isopeptides. The use of this biomolecule in peptide synthesis allows for the production of large quantities of peptides without racemization or epimerization that can occur with other methods. This synthetic method provides a means to produce both amino acid and dipeptide sequences, as well as the incorporation of non-natural amino acids.Formula:C28H34N2O8Purity:Min. 95%Molecular weight:526.58 g/molBoc-Ser(Val-Fmoc)-OH
CAS:Bachem ID: 4061393.
Formula:C28H34N2O8Purity:99.7%Color and Shape:White PowderMolecular weight:526.59


