CAS 944348-12-3

1-[3-(Trifluoromethyl)phenyl]cyclohexanemethanamine

Description:

1-[3-(Trifluoromethyl)phenyl]cyclohexanemethanamine, with the CAS number 944348-12-3, is a chemical compound characterized by its unique structure that includes a cyclohexane ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. The cyclohexane moiety contributes to the compound's three-dimensional conformation, which can affect its pharmacological properties if used in medicinal chemistry. Additionally, the trifluoromethyl group is known to impart stability and can modify the electronic characteristics of the molecule, potentially affecting its solubility and interaction with other chemical entities. Overall, this compound may have applications in various fields, including pharmaceuticals and materials science, due to its distinctive structural features and chemical behavior.

Formula: C₁₄H₁₈F₃N

InChI: InChI=1S/C14H18F3N/c15-14(16,17)12-6-4-5-11(9-12)13(10-18)7-2-1-3-8-13/h4-6,9H,1-3,7-8,10,18H2

InChI key: InChIKey=AUSNQSGELDROQW-UHFFFAOYSA-N

SMILES: C(N)C1(CCCCC1)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 1-[3-(Trifluoromethyl)phenyl]cyclohexanemethanamine
• [1-[3-(Trifluoromethyl)phenyl]cyclohexyl]methanamine
• Cyclohexanemethanamine, 1-[3-(trifluoromethyl)phenyl]-

{1-[3-(Trifluoromethyl)phenyl]cyclohexyl}methanamine

CAS: 944348-12-3

Versatile small molecule scaffold

Formula: C₁₄H₁₈F₃N

Purity: Min. 95%

Molecular weight: 257.29 g/mol

Ref: 3D-UMB34812