CymitQuimica logo

CAS 944390-66-3

:

5-Chloro-2-(piperidin-4-yloxy)pyridine dihydrochloride

Description:
5-Chloro-2-(piperidin-4-yloxy)pyridine dihydrochloride is a chemical compound characterized by its pyridine ring, which is substituted with a chlorine atom and a piperidine moiety. This compound is typically encountered as a dihydrochloride salt, enhancing its solubility in polar solvents, which is advantageous for various applications in medicinal chemistry and pharmacology. The presence of the piperidine group suggests potential interactions with biological targets, making it of interest in drug development. The chlorine substituent can influence the compound's electronic properties and reactivity, potentially affecting its biological activity. As a dihydrochloride, the compound is likely to exhibit good stability under standard conditions, although it should be handled with care due to the presence of chlorine, which can be reactive. Overall, this compound's unique structure may contribute to its potential as a pharmacological agent, warranting further investigation into its biological properties and applications.
Formula:C10H15Cl3N2O
InChI:InChI=1/C10H13ClN2O.2ClH/c11-8-1-2-10(13-7-8)14-9-3-5-12-6-4-9;;/h1-2,7,9,12H,3-6H2;2*1H
InChI key:RPQFZVSTDHPVMQ-UHFFFAOYSA-N
SMILES:c1cc(ncc1Cl)OC1CCNCC1.Cl.Cl
Found 2 products.