CAS 944390-73-2

Pyridine, 4-methyl-2-(4-piperidinyloxy)-, hydrochloride (1:2)

Description:

Pyridine, 4-methyl-2-(4-piperidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its unique properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature. The presence of the piperidinyloxy group enhances its potential for biological activity, making it of interest in medicinal chemistry and pharmacology. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound may exhibit various functional properties, including acting as a ligand or a building block in the synthesis of more complex molecules. Its specific applications can vary, but it is generally studied for its potential therapeutic effects, particularly in the context of neurological or psychiatric disorders. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₆N₂O.2ClH

InChI: InChI=1S/C11H16N2O.2ClH/c1-9-2-7-13-11(8-9)14-10-3-5-12-6-4-10;;/h2,7-8,10,12H,3-6H2,1H3;2*1H

InChI key: InChIKey=IQVPFAXPKBNJTR-UHFFFAOYSA-N

SMILES: O(C1=CC(C)=CC=N1)C2CCNCC2.Cl