CymitQuimica logo

CAS 944450-49-1

:

(OC-6-22)-Bis(acetato-κO,κO′)[1,1′-(4R)-[4,4′-bi-1,3-benzodioxole]-5,5′-diylbis[1,1-bis(3,5-dimethylphenyl)phosphine-κP]]ruthenium

Description:
The chemical substance known as "(OC-6-22)-Bis(acetato-κO,κO′)[1,1′-(4R)-[4,4′-bi-1,3-benzodioxole]-5,5′-diylbis[1,1-bis(3,5-dimethylphenyl)phosphine-κP]]ruthenium" with CAS number 944450-49-1 is a complex organometallic compound featuring a ruthenium center coordinated to multiple ligands. Its structure includes bis(acetato) groups, which are acetate ligands that coordinate through oxygen atoms, and a bidentate phosphine ligand system that enhances its stability and reactivity. The presence of the bi-1,3-benzodioxole moiety contributes to its unique electronic properties and potential applications in catalysis or materials science. This compound is characterized by its intricate ligand architecture, which can influence its chemical behavior, including its reactivity and interaction with substrates. Additionally, the presence of bulky substituents, such as the 3,5-dimethylphenyl groups, may affect steric hindrance and solubility in various solvents. Overall, this compound exemplifies the complexity and versatility of organometallic chemistry, particularly in the context of transition metal complexes.
Formula:C50H50O8P2Ru
InChI:InChI=1S/C46H44O4P2.2C2H4O2.Ru/c1-27-13-28(2)18-35(17-27)51(36-19-29(3)14-30(4)20-36)41-11-9-39-45(49-25-47-39)43(41)44-42(12-10-40-46(44)50-26-48-40)52(37-21-31(5)15-32(6)22-37)38-23-33(7)16-34(8)24-38;2*1-2(3)4;/h9-24H,25-26H2,1-8H3;2*1H3,(H,3,4);/q;;;+2/p-2
InChI key:InChIKey=ACKYBTAGKAINOG-UHFFFAOYSA-L
SMILES:CC=1[O-][Ru+2]23([P](C=4C(C=5C([P]2(C6=CC(C)=CC(C)=C6)C7=CC(C)=CC(C)=C7)=CC=C8C5OCO8)=C9C(=CC4)OCO9)(C%10=CC(C)=CC(C)=C%10)C%11=CC(C)=CC(C)=C%11)([O-]C(C)=O3)O1
Synonyms:
  • Ruthenium, bis(acetato-κO,κO′)[1,1′-(4R)-[4,4′-bi-1,3-benzodioxole]-5,5′-diylbis[1,1-bis(3,5-dimethylphenyl)phosphine-κP]]-, (OC-6-22)-
  • (OC-6-22)-Bis(acetato-κO,κO′)[1,1′-(4R)-[4,4′-bi-1,3-benzodioxole]-5,5′-diylbis[1,1-bis(3,5-dimethylphenyl)phosphine-κP]]ruthenium
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.