CAS 944450-89-9

2-bromo-1-[4-(3-bromo-2-thienyl)phenyl]ethanone

Description:

2-bromo-1-[4-(3-bromo-2-thienyl)phenyl]ethanone is an organic compound characterized by its complex structure, which includes a brominated thienyl group and a phenyl ring. This compound features a ketone functional group, indicated by the ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of bromine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including substitution and coupling reactions. The thienyl group, derived from thiophene, introduces heteroatoms into the structure, which can influence the compound's electronic properties and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features can also lead to interesting photophysical properties, potentially useful in materials science. As with many brominated compounds, care should be taken regarding its handling and environmental impact, as brominated organic compounds can pose toxicity risks. Overall, 2-bromo-1-[4-(3-bromo-2-thienyl)phenyl]ethanone is a versatile compound with potential applications across various fields of chemistry.

Formula: C₁₂H₈Br₂OS

InChI: InChI=1/C12H8Br2OS/c13-7-11(15)8-1-3-9(4-2-8)12-10(14)5-6-16-12/h1-6H,7H2

SMILES: c1cc(ccc1C(=O)CBr)c1c(ccs1)Br

4-(3-Bromothien-2-yl)phenacyl bromide

CAS: 944450-89-9

4-(3-Bromothien-2-yl)phenacyl bromide

Purity: 97%

Color and Shape: Yellow Solid

Molecular weight: 360.06g/mol

Ref: 54-OR14920