CAS 944467-88-3

2-Furancarboxylic acid, 4-(aminomethyl)-5-(1,1-dimethylethyl)-, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 4-(aminomethyl)-5-(1,1-dimethylethyl)-, hydrochloride (1:1), with the CAS number 944467-88-3, is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group and an aminomethyl substituent, contributing to its potential as a building block in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric properties, which can influence its reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it easier to handle in various applications. The compound may exhibit biological activity, potentially serving as a precursor in pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or literature reference for precise values. Overall, this compound represents a versatile structure in organic chemistry with potential applications in medicinal chemistry and material science.

Formula: C₁₀H₁₅NO₃·ClH

InChI: InChI=1S/C10H15NO3.ClH/c1-10(2,3)8-6(5-11)4-7(14-8)9(12)13;/h4H,5,11H2,1-3H3,(H,12,13);1H

InChI key: InChIKey=NAOBXCWAVCSSBI-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C(CN)C=C(C(O)=O)O1.Cl

Synonyms:

• 2-Furancarboxylic acid, 4-(aminomethyl)-5-(1,1-dimethylethyl)-, hydrochloride (1:1)