CAS 944467-91-8

3-Furancarboxylic acid, 4-(aminomethyl)-2-methyl-5-(2-methylpropyl)-, hydrochloride (1:1)

Description:

3-Furancarboxylic acid, 4-(aminomethyl)-2-methyl-5-(2-methylpropyl)-, hydrochloride (1:1), with CAS number 944467-91-8, is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group, an amino group, and branched alkyl substituents, contributing to its potential biological activity and solubility properties. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which typically enhances the compound's stability and solubility in aqueous solutions. The presence of both amino and carboxylic acid groups suggests that it may exhibit properties such as being a zwitterion or having the ability to participate in hydrogen bonding. This compound may be of interest in pharmaceutical research due to its structural features, which could influence its interaction with biological targets. However, specific applications, toxicity, and detailed biological activity would require further investigation and empirical data.

Formula: C₁₁H₁₇NO₃·ClH

InChI: InChI=1S/C11H17NO3.ClH/c1-6(2)4-9-8(5-12)10(11(13)14)7(3)15-9;/h6H,4-5,12H2,1-3H3,(H,13,14);1H

InChI key: InChIKey=YFUYATAFSLYBHV-UHFFFAOYSA-N

SMILES: C(N)C=1C(C(O)=O)=C(C)OC1CC(C)C.Cl

Synonyms:

• 3-Furancarboxylic acid, 4-(aminomethyl)-2-methyl-5-(2-methylpropyl)-, hydrochloride (1:1)

4-(Aminomethyl)-5-isobutyl-2-methyl-3-furoic acid hydrochloride

CAS: 944467-91-8

4-(Aminomethyl)-5-isobutyl-2-methyl-3-furoic acid hydrochloride

Purity: ≥95%

Ref: 54-OR13430