CAS 944511-54-0
:1-(1-Ethylpropyl)-5-oxo-3-pyrrolidinecarboxylic acid
Description:
1-(1-Ethylpropyl)-5-oxo-3-pyrrolidinecarboxylic acid, identified by its CAS number 944511-54-0, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is characterized by the presence of a carboxylic acid functional group and a ketone group at specific positions on the ring. The ethylpropyl substituent contributes to its unique structural properties, potentially influencing its solubility and reactivity. Generally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of both the carboxylic acid and ketone functionalities suggests potential for various chemical reactions, including esterification and amide formation. Additionally, the compound's stereochemistry and functional groups may play a significant role in its interaction with biological targets. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature reference for precise characterization.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-3-8(4-2)11-6-7(10(13)14)5-9(11)12/h7-8H,3-6H2,1-2H3,(H,13,14)
InChI key:InChIKey=SAABAXKBEHPTMY-UHFFFAOYSA-N
SMILES:C(CC)(CC)N1CC(C(O)=O)CC1=O
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-(1-ethylpropyl)-5-oxo-
- 1-(1-Ethylpropyl)-5-oxo-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
