CAS 94452-17-2
:N-[7-(beta-D-galactopyranosyloxy)-4-methyl-2-oxo-2H-chromen-6-yl]-2-methylpentadecanamide
Description:
N-[7-(beta-D-galactopyranosyloxy)-4-methyl-2-oxo-2H-chromen-6-yl]-2-methylpentadecanamide is a complex organic compound characterized by its unique structural features, which include a chromenone core, a sugar moiety (beta-D-galactopyranosyl), and a long-chain amide. The presence of the beta-D-galactopyranosyl group suggests that this compound may exhibit biological activity, potentially interacting with biological systems through glycosylation. The chromenone structure contributes to its potential as a bioactive molecule, possibly displaying antioxidant or anti-inflammatory properties. The long aliphatic chain (2-methylpentadecanamide) may enhance its lipophilicity, influencing its solubility and permeability in biological membranes. This compound's intricate structure indicates potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities and mechanisms would require further investigation. Overall, the combination of a sugar unit with a chromenone and an amide suggests a versatile compound with potential relevance in medicinal chemistry and biochemistry.
Formula:C32H49NO9
InChI:InChI=1/C32H49NO9/c1-4-5-6-7-8-9-10-11-12-13-14-15-20(2)31(39)33-23-17-22-21(3)16-27(35)40-24(22)18-25(23)41-32-30(38)29(37)28(36)26(19-34)42-32/h16-18,20,26,28-30,32,34,36-38H,4-15,19H2,1-3H3,(H,33,39)/t20?,26-,28+,29+,30-,32-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-Hexadecanoylamino-4-methylumbelliferyl b-D-Galactopyranoside
CAS:Formula:C32H49NO9Molecular weight:591.736-Hexadecanoylamino-4-methylumbelliferyl β-D-Galactopyranoside
CAS:Formula:C32H49NO9Color and Shape:NeatMolecular weight:591.736-Hexadecanoylamino-4-methylumbelliferyl b-D-galactopyranoside - Moscerdam™ biochemical purity
CAS:<p>Hexadecanoylamino-4-methylumbelliferyl b-D-galactopyranoside is a substrate used for the diagnosis of Krabbe disease. Krabbe disease (globoid cell leukodystrophy/ galactosylceramide lipidosis), is a rare and often fatal lysosomal storage disease that results in progressive damage to the nervous system. It is inherited in an autosomal recessive pattern and involves dysfunctional metabolism of sphingolipids (MG44866 b-D-Galactosylsphingosine - Synthetic)</p>Formula:C32H49NO9Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:591.73 g/mol


