CymitQuimica logo

CAS 944530-74-9

:

α-(3-Methoxyphenyl)-3-thiophenemethanol

Description:
α-(3-Methoxyphenyl)-3-thiophenemethanol, identified by its CAS number 944530-74-9, is an organic compound characterized by the presence of both a methoxyphenyl group and a thiophenemethanol moiety. This compound typically exhibits a complex structure that includes aromatic rings, which contribute to its potential for various chemical interactions and biological activities. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and stability. The thiophene ring, known for its electron-rich properties, can participate in various chemical reactions, including electrophilic substitutions. This compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, α-(3-Methoxyphenyl)-3-thiophenemethanol represents a versatile structure with potential applications in organic synthesis and drug development.
Formula:C12H12O2S
InChI:InChI=1S/C12H12O2S/c1-14-11-4-2-3-9(7-11)12(13)10-5-6-15-8-10/h2-8,12-13H,1H3
InChI key:InChIKey=JTPPEGQHZODPPZ-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=CC=C1)C=2C=CSC2
Synonyms:
  • α-(3-Methoxyphenyl)-3-thiophenemethanol
  • 3-Thiophenemethanol, α-(3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.