CAS 94454-57-6

3-benzyloxypyridine-2-carbaldehyde

Description:

3-Benzyloxypyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a benzyloxy group attached to the third position of the pyridine ring and an aldehyde functional group at the second position. This structure imparts both aromatic and polar characteristics to the molecule, influencing its reactivity and solubility. The presence of the aldehyde group makes it a potential candidate for various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the benzyloxy substituent can enhance the compound's lipophilicity, affecting its interaction with biological systems. 3-Benzyloxypyridine-2-carbaldehyde may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that can participate in further chemical transformations. Its unique structure and properties make it a valuable compound for research and application in various fields of chemistry.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1/C13H11NO2/c15-9-12-13(7-4-8-14-12)16-10-11-5-2-1-3-6-11/h1-9H,10H2

SMILES: c1ccc(cc1)COc1cccnc1C=O

Synonyms:

• 2-Pyridinecarboxaldehyde, 3-(Phenylmethoxy)-
• 3-(Benzyloxy)-2-pyridinecarbaldehyde
• 3-(Benzyloxy)pyridin-2-carbaldehyd
• 3-(Benzyloxy)pyridine-2-carbaldehyde