CAS 944549-41-1
:6-bromo-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine
Description:
6-Bromo-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine is a synthetic organic compound characterized by its complex structure, which includes a quinazoline core, bromine, chlorine, and fluorine substituents. The presence of the bromine atom at the 6-position and the chlorine atom at the 3-position of the phenyl ring contributes to its potential biological activity. The methoxy group linked to a phenyl ring enhances its lipophilicity, which may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinazoline derivatives are often explored for their anticancer and anti-inflammatory properties. Its molecular structure suggests that it may interact with specific biological targets, making it a candidate for further research in therapeutic contexts. The CAS number 944549-41-1 uniquely identifies this compound in chemical databases, facilitating its study and application in various scientific fields.
Formula:C21H14BrClFN3O
InChI:InChI=1/C21H14BrClFN3O/c22-14-4-6-19-17(9-14)21(26-12-25-19)27-16-5-7-20(18(23)10-16)28-11-13-2-1-3-15(24)8-13/h1-10,12H,11H2,(H,25,26,27)
SMILES:c1cc(cc(c1)F)COc1ccc(cc1Cl)Nc1c2cc(ccc2ncn1)Br
Synonyms:- N-(4-(3-fluorobenzyloxy)-3-chlorophenyl)-6-bromoquinazolin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.