CAS 944580-74-9

N-Cyclopropyl-6-(trifluoromethyl)-2-pyridinamine

Description:

N-Cyclopropyl-6-(trifluoromethyl)-2-pyridinamine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a cyclopropyl group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The cyclopropyl moiety contributes to the compound's rigidity and can affect its interaction with biological targets. This compound is typically studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the electronic effects of the trifluoromethyl group and the steric effects of the cyclopropyl group. Overall, N-Cyclopropyl-6-(trifluoromethyl)-2-pyridinamine represents a class of compounds that may exhibit significant biological activity and warrant further investigation.

Formula: C₉H₉F₃N₂

InChI: InChI=1S/C9H9F3N2/c10-9(11,12)7-2-1-3-8(14-7)13-6-4-5-6/h1-3,6H,4-5H2,(H,13,14)

InChI key: InChIKey=LQVNHNDZYRLLIT-UHFFFAOYSA-N

SMILES: N(C=1N=C(C(F)(F)F)C=CC1)C2CC2

Synonyms:

• N-Cyclopropyl-6-(trifluoromethyl)-2-pyridinamine
• 2-Pyridinamine, N-cyclopropyl-6-(trifluoromethyl)-