CAS 944580-75-0

N-2-Propen-1-yl-6-(trifluoromethyl)-2-pyridinamine

Description:

N-2-Propen-1-yl-6-(trifluoromethyl)-2-pyridinamine, identified by its CAS number 944580-75-0, is a chemical compound that features a pyridine ring substituted with both a propenyl group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The propenyl group introduces a degree of unsaturation, which can participate in various chemical reactions, such as polymerization or addition reactions. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the presence of functional groups and the environment. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, which could be leveraged in materials science or organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₉F₃N₂

InChI: InChI=1S/C9H9F3N2/c1-2-6-13-8-5-3-4-7(14-8)9(10,11)12/h2-5H,1,6H2,(H,13,14)

InChI key: InChIKey=IFXRFUMNSMOLRR-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N=C(NCC=C)C=CC1

Synonyms:

• 2-Pyridinamine, N-2-propen-1-yl-6-(trifluoromethyl)-
• N-2-Propen-1-yl-6-(trifluoromethyl)-2-pyridinamine