CymitQuimica logo

CAS 94465-25-5

:

Methoxyphenylxanthenol; 97%

Description:
Methoxyphenylxanthenol, with the CAS number 94465-25-5, is a chemical compound that belongs to the xanthenol class, characterized by its structure which includes a xanthene core substituted with methoxy and phenyl groups. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including organic synthesis and as a fluorescent dye. Its molecular structure contributes to its photophysical properties, making it useful in fluorescence studies and as a potential marker in biological applications. The presence of the methoxy group can influence its solubility and reactivity, while the phenyl group may enhance its stability and interaction with other molecules. As with many chemical substances, handling should be done with care, adhering to safety protocols to mitigate any risks associated with exposure. Overall, Methoxyphenylxanthenol is a compound of interest in both research and industrial applications due to its unique chemical characteristics.
Formula:C20H16O3
InChI:InChI=1/C20H16O3/c1-22-15-12-10-14(11-13-15)20(21)16-6-2-4-8-18(16)23-19-9-5-3-7-17(19)20/h2-13,21H,1H3
InChI key:ZYACEJZTEMQQEU-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)C1(c2ccccc2Oc2ccccc12)O
Synonyms:
  • 9-(4-Methoxyphenyl)xanthen-9-ol
  • 9-(4-methoxyphenyl)-9H-xanthen-9-ol
  • 9H-Xanthen-9-ol, 9-(4-methoxyphenyl)-
Found 5 products.