CAS 944663-31-4

4-(1H-tetrazol-1-yl)benzene-1,2-diamine

Description:

4-(1H-tetrazol-1-yl)benzene-1,2-diamine is an organic compound characterized by its unique structure, which includes a benzene ring substituted with both a tetrazole group and two amino groups. The presence of the tetrazole moiety contributes to its potential as a bioactive compound, often associated with various pharmacological activities. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. Its chemical properties are influenced by the electron-donating nature of the amino groups and the electron-withdrawing characteristics of the tetrazole ring. This compound may be of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or as a building block in organic synthesis. Additionally, its stability and reactivity can vary depending on environmental conditions such as pH and temperature, making it a subject of study in various chemical contexts.

Formula: C₇H₈N₆

InChI: InChI=1/C7H8N6/c8-6-2-1-5(3-7(6)9)13-4-10-11-12-13/h1-4H,8-9H2

SMILES: c1cc(c(cc1n1cnnn1)N)N

4-(1H-tetrazol-1-yl)-1,2-benzenediamine

CAS: 944663-31-4

Formula: C₇H₈N₆

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 176.183

Ref: 10-F311369