CymitQuimica logo

CAS 944671-66-3

:

α-(2,4-Dimethylphenyl)-2-thiophenemethanol

Description:
α-(2,4-Dimethylphenyl)-2-thiophenemethanol, identified by its CAS number 944671-66-3, is an organic compound characterized by its unique structure that includes a thiophene ring and a phenolic group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, reactivity, and potential applications. The presence of the dimethylphenyl group suggests that it may have enhanced hydrophobic characteristics, while the thiophene moiety can contribute to electronic properties, making it of interest in materials science and organic electronics. Additionally, the hydroxyl (-OH) group in the structure can impart hydrogen-bonding capabilities, affecting its interactions in various chemical environments. Such compounds are often studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H14OS
InChI:InChI=1S/C13H14OS/c1-9-5-6-11(10(2)8-9)13(14)12-4-3-7-15-12/h3-8,13-14H,1-2H3
InChI key:InChIKey=HJXOBBCYUKKXJN-UHFFFAOYSA-N
SMILES:C(O)(C1=C(C)C=C(C)C=C1)C2=CC=CS2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.