CymitQuimica logo

CAS 944709-40-4

:

6-Chlorofuro[2,3-d]pyrimidin-4-amine

Description:
6-Chlorofuro[2,3-d]pyrimidin-4-amine is a heterocyclic compound characterized by its fused furo and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position of the furo ring enhances its reactivity and may influence its biological activity. This compound typically exhibits moderate to high solubility in polar solvents, which is common for nitrogen-containing heterocycles. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine functional group that can participate in hydrogen bonding and other interactions. The compound may also exhibit interesting electronic properties due to the conjugated system formed by the fused rings. As with many heterocycles, it may be subject to various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.
Formula:C6H4ClN3O
InChI:InChI=1S/C6H4ClN3O/c7-4-1-3-5(8)9-2-10-6(3)11-4/h1-2H,(H2,8,9,10)
InChI key:InChIKey=XWGCJIVUONLQAO-UHFFFAOYSA-N
SMILES:NC1=C2C(OC(Cl)=C2)=NC=N1
Synonyms:
  • Furo[2,3-d]pyrimidin-4-amine, 6-chloro-
  • 6-Chlorofuro[2,3-d]pyrimidin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.