CAS 944709-42-6

6,8-dibromo-[1,2,4]triazolo[1,5-a]pyrazine

Description:

6,8-Dibromo-[1,2,4]triazolo[1,5-a]pyrazine is a heterocyclic compound characterized by its fused triazole and pyrazine rings, which contribute to its unique chemical properties. The presence of bromine substituents at the 6 and 8 positions enhances its reactivity and solubility in various organic solvents. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. Its structure allows for various functionalization, making it a versatile building block in synthetic chemistry. The compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects would depend on the context of its use and the presence of other functional groups. Additionally, the stability of the brominated compound under different conditions is an important consideration for its application in various chemical processes. Overall, 6,8-dibromo-[1,2,4]triazolo[1,5-a]pyrazine represents a significant compound in the study of heterocyclic chemistry.

Formula: C₅H₂Br₂N₄

InChI: InChI=1/C5H2Br2N4/c6-3-1-11-5(4(7)10-3)8-2-9-11/h1-2H

SMILES: c1c(Br)nc(c2ncnn12)Br

Synonyms:

• [1,2,4]Triazolo[1,5-A]Pyrazine, 6,8-Dibromo-
• T56 Ann Dn Gnj Fe He
• 6,8-Dibromo[1,2,4]triazolo[1,5-a]pyrazine

6,8-Dibromo[1,2,4]triazolo[1,5-a]pyrazine

CAS: 944709-42-6

Formula: C₅H₂Br₂N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 277.9042

Ref: IN-DA006ABU

6,8-Dibromo-[1,2,4]triazolo[1,5-a]pyrazine

CAS: 944709-42-6

6,8-Dibromo-[1,2,4]triazolo[1,5-a]pyrazine

Purity: 97%

Molecular weight: 277.90g/mol

Ref: 54-OR75687

6,8-Dibromo[1,2,4]triazolo[1,5-a]pyrazine

CAS: 944709-42-6

Formula: C₅H₂Br₂N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 277.907

Ref: 10-F077040