CAS 944709-53-9
:5,7-Dichlorooxazolo[5,4-d]pyrimidine
Description:
5,7-Dichlorooxazolo[5,4-d]pyrimidine is a heterocyclic compound characterized by its fused oxazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 5 and 7 positions enhances its reactivity and solubility in various organic solvents. This compound is typically utilized in medicinal chemistry and drug development due to its potential biological activity, particularly as a scaffold for designing novel pharmaceuticals. Its structure allows for various substitution reactions, making it versatile in synthetic applications. Additionally, the compound's stability under standard laboratory conditions and its ability to participate in electrophilic and nucleophilic reactions further underscore its significance in organic synthesis. As with many halogenated compounds, safety precautions should be observed when handling 5,7-Dichlorooxazolo[5,4-d]pyrimidine, as halogens can impart toxicity and environmental concerns. Overall, this compound represents an interesting subject for research in both synthetic and medicinal chemistry.
Formula:C5HCl2N3O
InChI:InChI=1S/C5HCl2N3O/c6-3-2-4(11-1-8-2)10-5(7)9-3/h1H
InChI key:InChIKey=RLOQLWRJZNTGQX-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(Cl)=N1)OC=N2
Synonyms:- 5,7-Dichlorooxazolo[5,4-d]pyrimidine
- Oxazolo[5,4-d]pyrimidine, 5,7-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.