CymitQuimica logo

CAS 944709-58-4

:

ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate

Description:
Ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is a chemical compound characterized by its complex structure, which includes a furo[2,3-b]pyridine ring system and an ethyl ester functional group. This compound features a bromine atom at the 2-position of the furo-pyridine framework, which can influence its reactivity and potential applications in organic synthesis. The presence of the carboxylate group enhances its solubility in polar solvents and may facilitate various chemical reactions, such as nucleophilic substitutions or coupling reactions. Ethyl 2-bromofuro[2,3-b]pyridine-5-carboxylate is likely to exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features may also contribute to its potential as a building block in the synthesis of more complex molecules. As with many brominated compounds, it is important to handle this substance with care due to potential toxicity and environmental considerations.
Formula:C10H8BrNO3
InChI:InChI=1/C10H8BrNO3/c1-2-14-10(13)7-3-6-4-8(11)15-9(6)12-5-7/h3-5H,2H2,1H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.