CAS 944709-61-9

Ethyl 4-chloroimidazo[1,5-a]pyrimidine-3-carboxylate

Description:

Ethyl 4-chloroimidazo[1,5-a]pyrimidine-3-carboxylate is a chemical compound characterized by its unique imidazo-pyrimidine structure, which incorporates both a chloro substituent and an ethyl ester functional group. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chloro group can influence its reactivity and biological activity, while the ethyl ester moiety may enhance its solubility and bioavailability. Ethyl 4-chloroimidazo[1,5-a]pyrimidine-3-carboxylate is often synthesized through specific organic reactions that allow for the formation of the imidazo and pyrimidine rings. Its properties, such as melting point, boiling point, and solubility, can vary based on the conditions of synthesis and purity. As a compound of interest, it may be studied for its potential therapeutic effects, particularly in areas related to cancer research or antimicrobial activity, although specific biological data would require further investigation.

Formula: C₉H₈ClN₃O₂

InChI: InChI=1S/C9H8ClN3O2/c1-2-15-9(14)6-3-12-7-4-11-5-13(7)8(6)10/h3-5H,2H2,1H3

InChI key: InChIKey=COUJZDRXSNRQGU-UHFFFAOYSA-N

SMILES: ClC=1N2C(N=CC1C(OCC)=O)=CN=C2

Synonyms:

• Imidazo[1,5-a]pyrimidine-3-carboxylic acid, 4-chloro-, ethyl ester
• Ethyl 4-chloroimidazo[1,5-a]pyrimidine-3-carboxylate