CymitQuimica logo

CAS 944718-10-9

:

2-(Bromomethyl)-2,3-dihydro-6-methoxy-1H-isoindol-1-one

Description:
2-(Bromomethyl)-2,3-dihydro-6-methoxy-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a fused bicyclic system. The presence of a bromomethyl group indicates that it has a bromine atom attached to a carbon chain, enhancing its reactivity and potential for further chemical modifications. The methoxy group contributes to its solubility and can influence its electronic properties, making it a candidate for various applications in organic synthesis and medicinal chemistry. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its molecular structure suggests potential uses in pharmaceuticals or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, the specific properties such as melting point, boiling point, and solubility would depend on the conditions and purity of the substance. Safety data should be consulted for handling and storage, as the presence of bromine can pose hazards.
Formula:C10H10BrNO2
InChI:InChI=1S/C10H10BrNO2/c1-14-8-3-2-7-5-12(6-11)10(13)9(7)4-8/h2-4H,5-6H2,1H3
InChI key:InChIKey=KJOPVBGYBVIAEN-UHFFFAOYSA-N
SMILES:O=C1C=2C(CN1CBr)=CC=C(OC)C2
Synonyms:
  • 2-(Bromomethyl)-6-methoxy-3H-isoindol-1-one
  • 1H-Isoindol-1-one, 2-(bromomethyl)-2,3-dihydro-6-methoxy-
  • 2-(Bromomethyl)-2,3-dihydro-6-methoxy-1H-isoindol-1-one
  • 2-(Bromomethyl)-6-methoxyisoindolin-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.