CAS 944804-96-0

N-[4-[(Dimethylamino)methyl]-2-thiazolyl]acetamide

Description:

N-[4-[(Dimethylamino)methyl]-2-thiazolyl]acetamide is a chemical compound characterized by its thiazole ring, which contributes to its biological activity. The presence of a dimethylamino group enhances its solubility and potential interaction with biological targets, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate polarity due to the amide functional group, which can participate in hydrogen bonding. Its thiazole moiety may impart specific reactivity and stability under various conditions. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Additionally, the presence of the acetamide group indicates that it may have a role in modulating biological activity through interactions with enzymes or receptors. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-[4-[(Dimethylamino)methyl]-2-thiazolyl]acetamide represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₈H₁₃N₃OS

InChI: InChI=1S/C8H13N3OS/c1-6(12)9-8-10-7(5-13-8)4-11(2)3/h5H,4H2,1-3H3,(H,9,10,12)

InChI key: InChIKey=XBWPUPBLCWESMS-UHFFFAOYSA-N

SMILES: C(N(C)C)C=1N=C(NC(C)=O)SC1

Synonyms:

• N-[4-[(Dimethylamino)methyl]thiazol-2-yl]acetamide
• Acetamide, N-[4-[(dimethylamino)methyl]-2-thiazolyl]-
• N-[4-[(Dimethylamino)methyl]-2-thiazolyl]acetamide