CAS 944805-23-6

6-Bromo-5-fluoro-2(3H)-benzoxazolone

Description:

6-Bromo-5-fluoro-2(3H)-benzoxazolone is a heterocyclic organic compound characterized by its benzoxazolone structure, which features a fused benzene and oxazolone ring. The presence of bromine and fluorine substituents at specific positions on the aromatic ring significantly influences its chemical reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents, and its reactivity can be attributed to the electron-withdrawing effects of the halogen substituents, which can enhance electrophilic aromatic substitution reactions. Additionally, the benzoxazolone moiety is known for its potential applications in pharmaceuticals and materials science, particularly in the development of dyes and agrochemicals. The compound may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups in a reaction environment. Overall, 6-Bromo-5-fluoro-2(3H)-benzoxazolone represents a versatile building block in organic synthesis and research.

Formula: C₇H₃BrFNO₂

InChI: InChI=1S/C7H3BrFNO2/c8-3-1-6-5(2-4(3)9)10-7(11)12-6/h1-2H,(H,10,11)

InChI key: InChIKey=FVCBRNQTYMAPPS-UHFFFAOYSA-N

SMILES: FC=1C=C2C(=CC1Br)OC(=O)N2

Synonyms:

• 6-Bromo-5-fluorobenzo[d]oxazol-2(3H)-one
• 6-Bromo-5-fluoro-2(3H)-benzoxazolone
• 2(3H)-Benzoxazolone, 6-bromo-5-fluoro-
• 6-Bromo-5-fluoro-2,3-dihydro-1,3-benzoxazol-2-one
• 6-bromo-5-fluoro-1,3-benzoxazol-2(3H)-one
• 6-Bromo-5-fluoro-3H-benzooxazol-2-one

6-Bromo-5-fluoro-2,3-dihydro-1,3-benzoxazol-2-one

CAS: 944805-23-6

Versatile small molecule scaffold

Formula: C₇H₃BrFNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 232.01 g/mol

Ref: 3D-UMB80523