CymitQuimica logo

CAS 944805-61-2

:

5-Bromo-3-methoxy-2-(trifluoromethyl)pyridine

Description:
5-Bromo-3-methoxy-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 3-position contributes to its reactivity and solubility properties. The trifluoromethyl group at the 2-position enhances the compound's lipophilicity and can influence its biological activity. This compound is typically used in medicinal chemistry and agrochemical applications due to its potential as a building block for more complex molecules. Its unique combination of halogen and functional groups may impart specific pharmacological properties, making it of interest in drug discovery. Additionally, the trifluoromethyl group is known to increase metabolic stability and bioavailability in pharmaceutical compounds. Overall, 5-Bromo-3-methoxy-2-(trifluoromethyl)pyridine exhibits characteristics that make it valuable in various chemical research and development contexts.
Formula:C7H5BrF3NO
InChI:InChI=1S/C7H5BrF3NO/c1-13-5-2-4(8)3-12-6(5)7(9,10)11/h2-3H,1H3
InChI key:InChIKey=PNGHLWFANAWPAO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(OC)C=C(Br)C=N1
Synonyms:
  • 5-Bromo-3-methoxy-2-trifluoromethylpyridine
  • Pyridine, 5-bromo-3-methoxy-2-(trifluoromethyl)-
  • 5-Bromo-3-methoxy-2-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.