CAS 94481-79-5
:(6S,7aS)-6-hydroxy-7,7a-dihydro-1-benzofuran-2(6H)-one
Description:
The chemical substance known as (6S,7aS)-6-hydroxy-7,7a-dihydro-1-benzofuran-2(6H)-one, with the CAS number 94481-79-5, is a bicyclic compound characterized by a benzofuran core structure. This compound features a hydroxyl group at the 6-position and a lactone functionality, which contributes to its reactivity and potential biological activity. The stereochemistry indicated by the (6S,7aS) configuration suggests specific spatial arrangements of its atoms, which can influence its interactions in biological systems. This compound may exhibit properties such as solubility in organic solvents, and its hydroxyl group can participate in hydrogen bonding, affecting its physical and chemical behavior. Additionally, compounds of this type are often studied for their potential pharmacological properties, including anti-inflammatory or antioxidant activities. The presence of the benzofuran moiety is significant in medicinal chemistry, as it is a common scaffold in various bioactive compounds. Overall, this substance represents a unique structure with potential applications in research and development within the fields of organic and medicinal chemistry.
Formula:C8H8O3
InChI:InChI=1/C8H8O3/c9-6-2-1-5-3-8(10)11-7(5)4-6/h1-3,6-7,9H,4H2/t6-,7+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(6s,7as)-6-hydroxy-7,7a-dihydro-1-benzofuran-2(6h)-one
CAS:Formula:C8H8O3Purity:97.0%Molecular weight:152.1473Aquilegiolide
CAS:<p>Aquilegiolide is a sesquiterpene lactone, which is a naturally occurring organic compound. It is derived from plants, specifically those in the genus Aquilegia, known for their medicinal properties. The compound is characterized by its complex bicyclic ring structure that confers significant biochemical activity.</p>Formula:C8H8O3Purity:Min. 95%Molecular weight:152.15 g/mol
