CymitQuimica logo

CAS 944836-47-9

:

(βS)-β-Aminobenzo[b]thiophene-3-propanol

Description:
(βS)-β-Aminobenzo[b]thiophene-3-propanol, identified by its CAS number 944836-47-9, is a chemical compound that features a unique structure combining a thiophene ring with an amino group and a propanol side chain. This compound is characterized by its chiral center, which contributes to its specific stereochemistry, denoted by the (βS) configuration. The presence of the amino group suggests potential basic properties, while the thiophene moiety may impart aromatic characteristics and influence its reactivity and interactions with biological systems. The propanol group adds hydrophilicity, which can affect solubility in various solvents. Such compounds are often of interest in medicinal chemistry due to their potential biological activities, including effects on neurotransmitter systems or other physiological pathways. The specific stereochemistry and functional groups can significantly influence the compound's pharmacokinetics and pharmacodynamics, making it a subject of interest for further research in drug development and therapeutic applications.
Formula:C11H13NOS
InChI:InChI=1S/C11H13NOS/c12-9(6-13)5-8-7-14-11-4-2-1-3-10(8)11/h1-4,7,9,13H,5-6,12H2/t9-/m0/s1
InChI key:InChIKey=HCPUSOBEETYGMN-VIFPVBQESA-N
SMILES:C([C@@H](CO)N)C=1C=2C(SC1)=CC=CC2
Synonyms:
  • (2S)-2-Amino-3-(1-benzothiophen-3-yl)propan-1-ol
  • (βS)-β-Aminobenzo[b]thiophene-3-propanol
  • Benzo[b]thiophene-3-propanol, β-amino-, (βS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.