CAS 944887-42-7
:6-pyrrolidin-1-yl-1,3-benzothiazol-2-amine
Description:
6-Pyrrolidin-1-yl-1,3-benzothiazol-2-amine is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a pyrrolidine ring. This compound typically exhibits properties associated with both heterocyclic amines and thiazole derivatives, making it of interest in medicinal chemistry and drug development. It may possess biological activity, potentially acting as a pharmacophore in various therapeutic applications. The presence of the pyrrolidine ring can contribute to its lipophilicity and ability to interact with biological targets, such as receptors or enzymes. Additionally, the benzothiazole component may enhance its stability and solubility in organic solvents. The compound's specific reactivity and interactions can be influenced by the functional groups present, which may affect its pharmacokinetic properties. Overall, 6-pyrrolidin-1-yl-1,3-benzothiazol-2-amine represents a class of compounds that could be explored for their potential in treating various diseases, although further studies would be necessary to fully elucidate its properties and applications.
Formula:C11H13N3S
InChI:InChI=1/C11H13N3S/c12-11-13-9-4-3-8(7-10(9)15-11)14-5-1-2-6-14/h3-4,7H,1-2,5-6H2,(H2,12,13)
SMILES:C1CCN(C1)c1ccc2c(c1)sc(=N)[nH]2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.