CAS 944896-61-1

Imidazo[1,2-a]pyrazine-3-methanamine

Description:

Imidazo[1,2-a]pyrazine-3-methanamine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. This compound features a methanamine group at the 3-position of the pyrazine ring, enhancing its potential for various chemical reactions and biological activities. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The structure of Imidazo[1,2-a]pyrazine-3-methanamine allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular framework may facilitate the formation of hydrogen bonds, influencing its reactivity and interaction with other molecules. Additionally, compounds of this class may exhibit diverse pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, making it a candidate for further research in material science and organic electronics.

Formula: C₇H₈N₄

InChI: InChI=1S/C7H8N4/c8-3-6-4-10-7-5-9-1-2-11(6)7/h1-2,4-5H,3,8H2

InChI key: InChIKey=ZAFPQELLPHZQTB-UHFFFAOYSA-N

SMILES: C(N)C=1N2C(=NC1)C=NC=C2

Synonyms:

• Imidazo[1,2-a]pyrazine-3-methanamine