CAS 944897-00-1

2-Methoxy-4-pyridinepropanamine

Description:

2-Methoxy-4-pyridinepropanamine is an organic compound characterized by its unique structure, which includes a pyridine ring and a propanamine moiety. This compound features a methoxy group (-OCH3) attached to the pyridine ring, influencing its chemical reactivity and solubility. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic (the aromatic ring) and hydrophilic (the amine and methoxy groups) components. The amine functional group can participate in hydrogen bonding, which may enhance its solubility in polar solvents. Additionally, the pyridine ring contributes to the compound's potential basicity and ability to act as a ligand in coordination chemistry. The presence of the methoxy group can also affect the electronic properties of the molecule, potentially influencing its reactivity in various chemical reactions. Overall, 2-Methoxy-4-pyridinepropanamine may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research and characterization.

Formula: C₉H₁₄N₂O

InChI: InChI=1S/C9H14N2O/c1-12-9-7-8(3-2-5-10)4-6-11-9/h4,6-7H,2-3,5,10H2,1H3

InChI key: InChIKey=RRXUYDVQFCVQMC-UHFFFAOYSA-N

SMILES: C(CCN)C=1C=C(OC)N=CC1

Synonyms:

• 4-Pyridinepropanamine, 2-methoxy-
• 2-Methoxy-4-pyridinepropanamine