CAS 944897-10-3

N-(1,3-Benzodioxol-5-ylmethyl)-1H-indole-4-methanamine

Description:

N-(1,3-Benzodioxol-5-ylmethyl)-1H-indole-4-methanamine, with the CAS number 944897-10-3, is a chemical compound characterized by its complex structure, which includes an indole moiety and a benzodioxole group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the indole structure suggests possible interactions with biological targets, as indoles are known for their roles in various pharmacological activities. The benzodioxole component may enhance solubility and stability, influencing the compound's reactivity and interaction with other molecules. Additionally, the methanamine functional group can participate in hydrogen bonding, which may affect the compound's overall behavior in biological systems. While specific physical and chemical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit moderate to high lipophilicity, making them of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its full pharmacological profile and potential applications.

Formula: C₁₇H₁₆N₂O₂

InChI: InChI=1S/C17H16N2O2/c1-2-13(14-6-7-19-15(14)3-1)10-18-9-12-4-5-16-17(8-12)21-11-20-16/h1-8,18-19H,9-11H2

InChI key: InChIKey=BFLFCHOLSNKEEE-UHFFFAOYSA-N

SMILES: C(NCC=1C=C2C(=CC1)OCO2)C3=C4C(NC=C4)=CC=C3

Synonyms:

• 1H-Indole-4-methanamine, N-(1,3-benzodioxol-5-ylmethyl)-
• N-(1,3-Benzodioxol-5-ylmethyl)-1H-indole-4-methanamine