CAS 944897-41-0

5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid

Description:

5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of a trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid functional group (-COOH) contributes to its acidity and reactivity, allowing for potential interactions in biochemical pathways. This compound is typically synthesized through specific organic reactions that introduce the trifluoromethyl and carboxylic acid functionalities onto the triazole framework. Its unique properties may lend it applications in crop protection, as well as in the development of novel therapeutic agents. Additionally, the trifluoromethyl group can impart stability and enhance the compound's performance in various chemical environments. Overall, 5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid is a versatile compound with significant potential in both research and industrial applications.

Formula: C₄H₂F₃N₃O₂

InChI: InChI=1S/C4H2F3N3O2/c5-4(6,7)3-8-1(2(11)12)9-10-3/h(H,11,12)(H,8,9,10)

InChI key: InChIKey=LFQNIGPMFGXDDD-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1NC(C(O)=O)=NN1

Synonyms:

• 1H-1,2,4-Triazole-3-carboxylic acid, 5-(trifluoromethyl)-
• 5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid

5-Trifluoromethyl-1H-1,2,4-triazole-3-carboxylic Acid

Controlled Product

CAS: 944897-41-0

Applications 5-Trifluoromethyl-1H-1,2,4-triazole-3-carboxylic Acid was used in the synthetic preparations of neprilysin inhibitors.
References Solomon, SD., et al.: Lancet., 20, 380 (2012);

Formula: C₄H₂F₃N₃O₂

Color and Shape: Neat

Molecular weight: 181.07

Ref: TR-T791860