CAS 944897-41-0
:5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid
Description:
5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of a trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid functional group (-COOH) contributes to its acidity and reactivity, allowing for potential interactions in biochemical pathways. This compound is typically synthesized through specific organic reactions that introduce the trifluoromethyl and carboxylic acid functionalities onto the triazole framework. Its unique properties may lend it applications in crop protection, as well as in the development of novel therapeutic agents. Additionally, the trifluoromethyl group can impart stability and enhance the compound's performance in various chemical environments. Overall, 5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid is a versatile compound with significant potential in both research and industrial applications.
Formula:C4H2F3N3O2
InChI:InChI=1S/C4H2F3N3O2/c5-4(6,7)3-8-1(2(11)12)9-10-3/h(H,11,12)(H,8,9,10)
InChI key:InChIKey=LFQNIGPMFGXDDD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1NC(C(O)=O)=NN1
Synonyms:- 1H-1,2,4-Triazole-3-carboxylic acid, 5-(trifluoromethyl)-
- 5-(Trifluoromethyl)-1H-1,2,4-triazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Trifluoromethyl-1H-1,2,4-triazole-3-carboxylic Acid
CAS:Controlled ProductApplications 5-Trifluoromethyl-1H-1,2,4-triazole-3-carboxylic Acid was used in the synthetic preparations of neprilysin inhibitors.
References Solomon, SD., et al.: Lancet., 20, 380 (2012);Formula:C4H2F3N3O2Color and Shape:NeatMolecular weight:181.07
