CAS 944897-49-8
:5-Methoxy-2-benzoxazolemethanamine
Description:
5-Methoxy-2-benzoxazolemethanamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a methanamine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxy group enhances its solubility and may influence its reactivity and interaction with biological targets. As a benzoxazole derivative, it may exhibit fluorescence and has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 944897-49-8, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses. While specific physical and chemical properties such as melting point, boiling point, and solubility may vary, compounds of this class are often studied for their roles in various biological processes and their potential therapeutic applications. Further research is necessary to fully elucidate its characteristics and potential uses in scientific and industrial contexts.
Formula:C9H10N2O2
InChI:InChI=1S/C9H10N2O2/c1-12-6-2-3-8-7(4-6)11-9(5-10)13-8/h2-4H,5,10H2,1H3
InChI key:InChIKey=YTJKOTYLRCBOCX-UHFFFAOYSA-N
SMILES:C(N)C1=NC=2C(O1)=CC=C(OC)C2
Synonyms:- 5-Methoxy-2-benzoxazolemethanamine
- 2-Benzoxazolemethanamine, 5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5-Methoxy-1,3-benzoxazol-2-yl)methylamine hydrochloride
CAS:Formula:C9H10N2O2Molecular weight:178.1879
