CAS 944897-52-3

3-(2-Methoxyphenyl)-1H-1,2,4-triazole-5-carboxylic acid

Description:

3-(2-Methoxyphenyl)-1H-1,2,4-triazole-5-carboxylic acid is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a methoxyphenyl substituent that enhances its potential for biological activity. The presence of the methoxy group can influence the compound's solubility and reactivity, while the triazole moiety is known for its role in various pharmacological applications, including antifungal and antimicrobial activities. The compound's structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, which can affect its interactions with biological targets. Additionally, the specific arrangement of atoms and functional groups may confer unique properties, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the diverse chemistry of triazoles and their derivatives in the context of pharmaceutical research.

Formula: C₁₀H₉N₃O₃

InChI: InChI=1S/C10H9N3O3/c1-16-7-5-3-2-4-6(7)8-11-9(10(14)15)13-12-8/h2-5H,1H3,(H,14,15)(H,11,12,13)

InChI key: InChIKey=MWJPEPMXELTOIK-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=2NC(C(O)=O)=NN2)C=CC=C1

Synonyms:

• 3-(2-Methoxyphenyl)-1H-1,2,4-triazole-5-carboxylic acid
• 1H-1,2,4-Triazole-5-carboxylic acid, 3-(2-methoxyphenyl)-

5-(2-Methoxyphenyl)-4H-1,2,4-triazole-3-carboxylic acid

CAS: 944897-52-3

Versatile small molecule scaffold

Formula: C₁₀H₉N₃O₃

Purity: Min. 95%

Molecular weight: 219.2 g/mol

Ref: 3D-UMB89752