
CAS 944897-53-4
:5-(Trifluoromethyl)-2-benzoxazolemethanamine
Description:
5-(Trifluoromethyl)-2-benzoxazolemethanamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a trifluoromethyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The benzoxazole moiety contributes to its potential as a pharmacophore, often associated with various biological activities, including antimicrobial and anticancer properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be attributed to the amine functional group, which can participate in various chemical reactions, such as nucleophilic substitutions. The compound's CAS number, 944897-53-4, allows for its identification in chemical databases and literature. Overall, 5-(Trifluoromethyl)-2-benzoxazolemethanamine is a compound of interest in research, particularly in the fields of organic synthesis and drug development.
Formula:C9H7F3N2O
InChI:InChI=1S/C9H7F3N2O/c10-9(11,12)5-1-2-7-6(3-5)14-8(4-13)15-7/h1-3H,4,13H2
InChI key:InChIKey=XSHLRKWXPLTSOE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C2C(OC(CN)=N2)=CC1
Synonyms:- 5-(Trifluoromethyl)-2-benzoxazolemethanamine
- 2-Benzoxazolemethanamine, 5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.