CymitQuimica logo

CAS 944897-59-0

:

5-Methyl-2-benzoxazolemethanamine

Description:
5-Methyl-2-benzoxazolemethanamine, identified by its CAS number 944897-59-0, is a chemical compound that features a benzoxazole ring, which is a bicyclic structure containing both benzene and oxazole moieties. This compound is characterized by the presence of a methyl group at the 5-position of the benzoxazole ring and an amine functional group attached to a methylene bridge. The presence of these functional groups suggests that it may exhibit properties such as basicity due to the amine, and potential reactivity in various chemical reactions, including nucleophilic substitutions. The compound may also possess biological activity, as many benzoxazole derivatives are known for their pharmacological properties. Its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and solvent. Overall, 5-Methyl-2-benzoxazolemethanamine is of interest in both synthetic chemistry and potential applications in medicinal chemistry, although specific data on its physical and chemical properties would require further investigation or experimental analysis.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-6-2-3-8-7(4-6)11-9(5-10)12-8/h2-4H,5,10H2,1H3
InChI key:InChIKey=CAMYACYQXPBFRW-UHFFFAOYSA-N
SMILES:C(N)C=1OC=2C(N1)=CC(C)=CC2
Synonyms:
  • 5-Methyl-2-benzoxazolemethanamine
  • 2-Benzoxazolemethanamine, 5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.